C36H52N6O8S — CID 87263589
[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-6-oxo-5-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]hexyl]-tert-butylcarbamic acid (PubChem CID 87263589) has the molecular formula C36H52N6O8S and a molecular weight of 728.91 g/mol. Its IUPAC name is [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-6-oxo-5-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]hexyl]-tert-butylcarbamic acid.
| Compound Name | [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-6-oxo-5-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]hexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87263589 |
| Molecular Formula | C36H52N6O8S |
| Molecular Weight | 728.91 g/mol |
| Exact Mass | 728.36 |
| IUPAC Name | [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-6-oxo-5-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]hexyl]-tert-butylcarbamic acid |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1csc2ccccc12)C(=O)[C@H](CCCCN(C(=O)O)C(C)(C)C)NC(=O)CONC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C36H52N6O8S/c1-7-48-33(49-8-2)25(3)41(22-27-24-51-30-15-10-9-13-28(27)30)32(44)29(14-11-12-20-42(35(46)47)36(4,5)6)39-31(43)23-50-40-34(45)38-21-26-16-18-37-19-17-26/h9-10,13,15-19,24-25,29,33H,7-8,11-12,14,20-23H2,1-6H3,(H,39,43)(H,46,47)(H2,38,40,45)/t25-,29-/m0/s1 |
| InChIKey | XVZQVRCNCMRMEC-SVEHJYQDSA-N |
| XLogP | 5.28 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|