C28H37N5O6S — CID 87259742
(2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]propanamide (PubChem CID 87259742) has the molecular formula C28H37N5O6S and a molecular weight of 571.70 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]propanamide |
|---|---|
| PubChem CID | 87259742 |
| Molecular Formula | C28H37N5O6S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-(pyridin-4-ylmethylcarbamoylamino)oxyacetyl]amino]propanamide |
| SMILES | CCOC(Cc1csc2ccccc12)(OCC)[C@H](C)NC(=O)[C@H](C)NC(=O)CONC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C28H37N5O6S/c1-5-37-28(38-6-2,15-22-18-40-24-10-8-7-9-23(22)24)20(4)32-26(35)19(3)31-25(34)17-39-33-27(36)30-16-21-11-13-29-14-12-21/h7-14,18-20H,5-6,15-17H2,1-4H3,(H,31,34)(H,32,35)(H2,30,33,36)/t19-,20-/m0/s1 |
| InChIKey | JNKIEXZCUNRMKC-PMACEKPBSA-N |
| XLogP | 3.05 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|