C30H41N5O5S — CID 67075344
(2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]propanamide (PubChem CID 67075344) has the molecular formula C30H41N5O5S and a molecular weight of 583.76 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 67075344 |
| Molecular Formula | C30H41N5O5S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | (2S)-N-[(2S)-4-(1-benzothiophen-3-yl)-3,3-diethoxybutan-2-yl]-2-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]propanamide |
| SMILES | CCOC(Cc1csc2ccccc12)(OCC)[C@H](C)NC(=O)[C@H](C)NC(=O)CN(C)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H41N5O5S/c1-6-39-30(40-7-2,17-24-20-41-26-16-12-11-15-25(24)26)22(4)33-28(37)21(3)32-27(36)19-35(5)34-29(38)31-18-23-13-9-8-10-14-23/h8-16,20-22H,6-7,17-19H2,1-5H3,(H,32,36)(H,33,37)(H2,31,34,38)/t21-,22-/m0/s1 |
| InChIKey | CURQNTADNKHJSY-VXKWHMMOSA-N |
| XLogP | 3.57 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|