C27H41N5O5 — CID 67075053
N-[(1S,2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]propanamide (PubChem CID 67075053) has the molecular formula C27H41N5O5 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[(1S,2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]propanamide.
| Compound Name | N-[(1S,2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 67075053 |
| Molecular Formula | C27H41N5O5 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | N-[(1S,2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]propanamide |
| SMILES | CCNC(=O)NN(C)CC(=O)NC(C)C(=O)N[C@H](c1cccc2ccccc12)[C@H](C)C(OCC)OCC |
| InChI | InChI=1S/C27H41N5O5/c1-7-28-27(35)31-32(6)17-23(33)29-19(5)25(34)30-24(18(4)26(36-8-2)37-9-3)22-16-12-14-20-13-10-11-15-21(20)22/h10-16,18-19,24,26H,7-9,17H2,1-6H3,(H,29,33)(H,30,34)(H2,28,31,35)/t18-,19?,24-/m0/s1 |
| InChIKey | JYZNROFHCIHUNX-GZODMWGESA-N |
| XLogP | 2.70 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|