C42H45N3O6 — CID 68827681
[(2S)-1-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid (PubChem CID 68827681) has the molecular formula C42H45N3O6 and a molecular weight of 687.84 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68827681 |
| Molecular Formula | C42H45N3O6 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | [(2S)-1-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid |
| SMILES | CCOC(OCC)[C@@H](C)C(NC(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C42H45N3O6/c1-4-50-40(51-5-2)29(3)38(35-27-17-19-30-18-15-16-26-34(30)35)44-39(47)36(43-41(48)49)28-37(46)45-42(31-20-9-6-10-21-31,32-22-11-7-12-23-32)33-24-13-8-14-25-33/h6-27,29,36,38,40,43H,4-5,28H2,1-3H3,(H,44,47)(H,45,46)(H,48,49)/t29-,36-,38?/m0/s1 |
| InChIKey | RFEOATVBURCWEX-QVUPPTRRSA-N |
| XLogP | 7.17 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|