C53H48N4O5 — CID 11388759
benzyl (2R)-2-[[(2S)-2-amino-4-oxo-4-(tritylamino)butanoyl]amino]-4-oxo-4-(tritylamino)butanoate (PubChem CID 11388759) has the molecular formula C53H48N4O5 and a molecular weight of 820.99 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2S)-2-amino-4-oxo-4-(tritylamino)butanoyl]amino]-4-oxo-4-(tritylamino)butanoate.
| Compound Name | benzyl (2R)-2-[[(2S)-2-amino-4-oxo-4-(tritylamino)butanoyl]amino]-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 11388759 |
| Molecular Formula | C53H48N4O5 |
| Molecular Weight | 820.99 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | benzyl (2R)-2-[[(2S)-2-amino-4-oxo-4-(tritylamino)butanoyl]amino]-4-oxo-4-(tritylamino)butanoate |
| SMILES | N[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C53H48N4O5/c54-46(36-48(58)56-52(40-24-10-2-11-25-40,41-26-12-3-13-27-41)42-28-14-4-15-29-42)50(60)55-47(51(61)62-38-39-22-8-1-9-23-39)37-49(59)57-53(43-30-16-5-17-31-43,44-32-18-6-19-33-44)45-34-20-7-21-35-45/h1-35,46-47H,36-38,54H2,(H,55,60)(H,56,58)(H,57,59)/t46-,47+/m0/s1 |
| InChIKey | GOPPDUJUGLZRJG-KBRGEABDSA-N |
| XLogP | 7.54 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.99 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|