C39H36N2O5 — CID 11157796
benzyl (2S)-4-oxo-2-(phenylmethoxycarbonylaminomethyl)-4-(tritylamino)butanoate (PubChem CID 11157796) has the molecular formula C39H36N2O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is benzyl (2S)-4-oxo-2-(phenylmethoxycarbonylaminomethyl)-4-(tritylamino)butanoate.
| Compound Name | benzyl (2S)-4-oxo-2-(phenylmethoxycarbonylaminomethyl)-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 11157796 |
| Molecular Formula | C39H36N2O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | benzyl (2S)-4-oxo-2-(phenylmethoxycarbonylaminomethyl)-4-(tritylamino)butanoate |
| SMILES | O=C(C[C@@H](CNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H36N2O5/c42-36(41-39(33-20-10-3-11-21-33,34-22-12-4-13-23-34)35-24-14-5-15-25-35)26-32(37(43)45-28-30-16-6-1-7-17-30)27-40-38(44)46-29-31-18-8-2-9-19-31/h1-25,32H,26-29H2,(H,40,44)(H,41,42)/t32-/m0/s1 |
| InChIKey | MVUJYPVYQLVYRR-YTTGMZPUSA-N |
| XLogP | 6.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|