C38H46N2O4Si — CID 173248538
benzyl N-[(4S)-5-dimethylsilyloxy-6,6-dimethyl-1-oxo-1-(tritylamino)heptan-4-yl]carbamate (PubChem CID 173248538) has the molecular formula C38H46N2O4Si and a molecular weight of 622.88 g/mol. Its IUPAC name is benzyl N-[(4S)-5-dimethylsilyloxy-6,6-dimethyl-1-oxo-1-(tritylamino)heptan-4-yl]carbamate.
| Compound Name | benzyl N-[(4S)-5-dimethylsilyloxy-6,6-dimethyl-1-oxo-1-(tritylamino)heptan-4-yl]carbamate |
|---|---|
| PubChem CID | 173248538 |
| Molecular Formula | C38H46N2O4Si |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | benzyl N-[(4S)-5-dimethylsilyloxy-6,6-dimethyl-1-oxo-1-(tritylamino)heptan-4-yl]carbamate |
| SMILES | C[SiH](C)OC([C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H46N2O4Si/c1-37(2,3)35(44-45(4)5)33(39-36(42)43-28-29-18-10-6-11-19-29)26-27-34(41)40-38(30-20-12-7-13-21-30,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-25,33,35,45H,26-28H2,1-5H3,(H,39,42)(H,40,41)/t33-,35?/m0/s1 |
| InChIKey | UYKLDBRDDLQQND-ITLBEBSESA-N |
| XLogP | 7.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|