C30H28N2O3 — CID 11488105
benzyl (2R)-2-amino-4-oxo-4-(tritylamino)butanoate (PubChem CID 11488105) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is benzyl (2R)-2-amino-4-oxo-4-(tritylamino)butanoate.
| Compound Name | benzyl (2R)-2-amino-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 11488105 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | benzyl (2R)-2-amino-4-oxo-4-(tritylamino)butanoate |
| SMILES | N[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H28N2O3/c31-27(29(34)35-22-23-13-5-1-6-14-23)21-28(33)32-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27H,21-22,31H2,(H,32,33)/t27-/m1/s1 |
| InChIKey | ZTAXRWLYJIUFFR-HHHXNRCGSA-N |
| XLogP | 4.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|