C25H37N3O5 — CID 87259608
[(2S)-5-amino-2-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 87259608) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is [(2S)-5-amino-2-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | [(2S)-5-amino-2-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 87259608 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | [(2S)-5-amino-2-[[(2S)-3,3-diethoxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)[C@@H](C)C(N[C@@H](CCC(N)C=O)CNC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H37N3O5/c1-4-32-24(33-5-2)17(3)23(22-12-8-10-18-9-6-7-11-21(18)22)28-20(15-27-25(30)31)14-13-19(26)16-29/h6-12,16-17,19-20,23-24,27-28H,4-5,13-15,26H2,1-3H3,(H,30,31)/t17-,19?,20-,23?/m0/s1 |
| InChIKey | UEFPHRABMRAJFR-ZWOUTAOBSA-N |
| XLogP | 3.45 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|