C25H37N3O5 — CID 87259609
[5-amino-2-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-6-oxohexyl]carbamic acid (PubChem CID 87259609) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is [5-amino-2-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-6-oxohexyl]carbamic acid.
| Compound Name | [5-amino-2-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 87259609 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | [5-amino-2-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2ccccc12)C(CCC(N)C=O)CNC(=O)O |
| InChI | InChI=1S/C25H37N3O5/c1-4-32-24(33-5-2)18(3)28(22(15-27-25(30)31)14-13-21(26)17-29)16-20-11-8-10-19-9-6-7-12-23(19)20/h6-12,17-18,21-22,24,27H,4-5,13-16,26H2,1-3H3,(H,30,31)/t18-,21?,22?/m0/s1 |
| InChIKey | IXSCPTIRGSVTQK-XTWGIRIWSA-N |
| XLogP | 3.37 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|