C19H24O4 — CID 11723294
ethyl (2S,3S)-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-1-ylhexanoate (PubChem CID 11723294) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl (2S,3S)-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-1-ylhexanoate.
| Compound Name | ethyl (2S,3S)-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-1-ylhexanoate |
|---|---|
| PubChem CID | 11723294 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | ethyl (2S,3S)-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-1-ylhexanoate |
| SMILES | CCOC(=O)[C@@H](CO)[C@@H](O)CCCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H24O4/c1-2-23-19(22)17(13-20)18(21)12-6-10-15-9-5-8-14-7-3-4-11-16(14)15/h3-5,7-9,11,17-18,20-21H,2,6,10,12-13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | RCIMMRYUJUZPOV-ROUUACIJSA-N |
| XLogP | 2.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |