C38H38O4 — CID 10257188
(2S,3S)-3-hydroxy-8-naphthalen-1-yl-2-(trityloxymethyl)octanoic acid (PubChem CID 10257188) has the molecular formula C38H38O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-8-naphthalen-1-yl-2-(trityloxymethyl)octanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-8-naphthalen-1-yl-2-(trityloxymethyl)octanoic acid |
|---|---|
| PubChem CID | 10257188 |
| Molecular Formula | C38H38O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (2S,3S)-3-hydroxy-8-naphthalen-1-yl-2-(trityloxymethyl)octanoic acid |
| SMILES | O=C(O)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)CCCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C38H38O4/c39-36(27-12-1-5-16-29-18-15-19-30-17-13-14-26-34(29)30)35(37(40)41)28-42-38(31-20-6-2-7-21-31,32-22-8-3-9-23-32)33-24-10-4-11-25-33/h2-4,6-11,13-15,17-26,35-36,39H,1,5,12,16,27-28H2,(H,40,41)/t35-,36-/m0/s1 |
| InChIKey | KJSTUYMKTNMHIO-ZPGRZCPFSA-N |
| XLogP | 8.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|