C37H34N2O4 — CID 10415617
(2R,3R)-3-hydroxy-5-(3-phenyldiazenylphenyl)-2-(trityloxymethyl)pentanoic acid (PubChem CID 10415617) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-5-(3-phenyldiazenylphenyl)-2-(trityloxymethyl)pentanoic acid.
| Compound Name | (2R,3R)-3-hydroxy-5-(3-phenyldiazenylphenyl)-2-(trityloxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 10415617 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | (2R,3R)-3-hydroxy-5-(3-phenyldiazenylphenyl)-2-(trityloxymethyl)pentanoic acid |
| SMILES | O=C(O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](O)CCc1cccc(/N=N/c2ccccc2)c1 |
| InChI | InChI=1S/C37H34N2O4/c40-35(25-24-28-14-13-23-33(26-28)39-38-32-21-11-4-12-22-32)34(36(41)42)27-43-37(29-15-5-1-6-16-29,30-17-7-2-8-18-30)31-19-9-3-10-20-31/h1-23,26,34-35,40H,24-25,27H2,(H,41,42)/b39-38+/t34-,35-/m1/s1 |
| InChIKey | SXRFRTGREIFYDA-CASJRBHUSA-N |
| XLogP | 8.10 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|