C48H46O6 — CID 22610383
methyl 3-[2-[3-[(3R,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzoate (PubChem CID 22610383) has the molecular formula C48H46O6 and a molecular weight of 718.89 g/mol. Its IUPAC name is methyl 3-[2-[3-[(3R,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzoate.
| Compound Name | methyl 3-[2-[3-[(3R,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 22610383 |
| Molecular Formula | C48H46O6 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | methyl 3-[2-[3-[(3R,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzoate |
| SMILES | COC(=O)c1cccc(CCc2cccc(CC[C@@H](O)[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C48H46O6/c1-52-46(50)40-21-15-20-38(33-40)29-28-36-18-14-19-37(32-36)30-31-45(49)44(47(51)53-34-39-16-6-2-7-17-39)35-54-48(41-22-8-3-9-23-41,42-24-10-4-11-25-42)43-26-12-5-13-27-43/h2-27,32-33,44-45,49H,28-31,34-35H2,1H3/t44-,45+/m0/s1 |
| InChIKey | ITIVXVQZVPKHFC-YWPUXERESA-N |
| XLogP | 8.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|