C36H38O6 — CID 10393151
1-O-benzyl 8-O-methyl (2S,3S)-3-hydroxy-2-(trityloxymethyl)octanedioate (PubChem CID 10393151) has the molecular formula C36H38O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is 1-O-benzyl 8-O-methyl (2S,3S)-3-hydroxy-2-(trityloxymethyl)octanedioate.
| Compound Name | 1-O-benzyl 8-O-methyl (2S,3S)-3-hydroxy-2-(trityloxymethyl)octanedioate |
|---|---|
| PubChem CID | 10393151 |
| Molecular Formula | C36H38O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 1-O-benzyl 8-O-methyl (2S,3S)-3-hydroxy-2-(trityloxymethyl)octanedioate |
| SMILES | COC(=O)CCCC[C@H](O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H38O6/c1-40-34(38)25-15-14-24-33(37)32(35(39)41-26-28-16-6-2-7-17-28)27-42-36(29-18-8-3-9-19-29,30-20-10-4-11-21-30)31-22-12-5-13-23-31/h2-13,16-23,32-33,37H,14-15,24-27H2,1H3/t32-,33-/m0/s1 |
| InChIKey | GRAZADBQIPMWBT-LQJZCPKCSA-N |
| XLogP | 6.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|