C50H48O8 — CID 10485371
dimethyl 4-[2-[3-[(3R,4R)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzene-1,2-dicarboxylate (PubChem CID 10485371) has the molecular formula C50H48O8 and a molecular weight of 776.93 g/mol. Its IUPAC name is dimethyl 4-[2-[3-[(3R,4R)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[2-[3-[(3R,4R)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10485371 |
| Molecular Formula | C50H48O8 |
| Molecular Weight | 776.93 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | dimethyl 4-[2-[3-[(3R,4R)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]phenyl]ethyl]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(CCc2cccc(CC[C@@H](O)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)OCc3ccccc3)c2)cc1C(=O)OC |
| InChI | InChI=1S/C50H48O8/c1-55-47(52)43-30-28-38(33-44(43)48(53)56-2)27-26-36-18-15-19-37(32-36)29-31-46(51)45(49(54)57-34-39-16-7-3-8-17-39)35-58-50(40-20-9-4-10-21-40,41-22-11-5-12-23-41)42-24-13-6-14-25-42/h3-25,28,30,32-33,45-46,51H,26-27,29,31,34-35H2,1-2H3/t45-,46-/m1/s1 |
| InChIKey | KHENKORVUPFTRW-AWSIMMLFSA-N |
| XLogP | 8.71 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.93 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|