C40H38O6 — CID 10258249
methyl 3-[(3S,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]benzoate (PubChem CID 10258249) has the molecular formula C40H38O6 and a molecular weight of 614.74 g/mol. Its IUPAC name is methyl 3-[(3S,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]benzoate.
| Compound Name | methyl 3-[(3S,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]benzoate |
|---|---|
| PubChem CID | 10258249 |
| Molecular Formula | C40H38O6 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | methyl 3-[(3S,4S)-3-hydroxy-5-oxo-5-phenylmethoxy-4-(trityloxymethyl)pentyl]benzoate |
| SMILES | COC(=O)c1cccc(CC[C@H](O)[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C40H38O6/c1-44-38(42)32-18-14-17-30(27-32)25-26-37(41)36(39(43)45-28-31-15-6-2-7-16-31)29-46-40(33-19-8-3-9-20-33,34-21-10-4-11-22-34)35-23-12-5-13-24-35/h2-24,27,36-37,41H,25-26,28-29H2,1H3/t36-,37-/m0/s1 |
| InChIKey | RTPVBXSRJNNJPU-BCRBLDSWSA-N |
| XLogP | 7.14 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|