C41H40O6 — CID 10484122
(2R,3R)-3-hydroxy-5-[3-[2-(4-methoxycarbonylphenyl)ethyl]phenyl]-2-(trityloxymethyl)pentanoic acid (PubChem CID 10484122) has the molecular formula C41H40O6 and a molecular weight of 628.76 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-5-[3-[2-(4-methoxycarbonylphenyl)ethyl]phenyl]-2-(trityloxymethyl)pentanoic acid.
| Compound Name | (2R,3R)-3-hydroxy-5-[3-[2-(4-methoxycarbonylphenyl)ethyl]phenyl]-2-(trityloxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 10484122 |
| Molecular Formula | C41H40O6 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | (2R,3R)-3-hydroxy-5-[3-[2-(4-methoxycarbonylphenyl)ethyl]phenyl]-2-(trityloxymethyl)pentanoic acid |
| SMILES | COC(=O)c1ccc(CCc2cccc(CC[C@@H](O)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C41H40O6/c1-46-40(45)33-25-22-30(23-26-33)20-21-31-12-11-13-32(28-31)24-27-38(42)37(39(43)44)29-47-41(34-14-5-2-6-15-34,35-16-7-3-8-17-35)36-18-9-4-10-19-36/h2-19,22-23,25-26,28,37-38,42H,20-21,24,27,29H2,1H3,(H,43,44)/t37-,38-/m1/s1 |
| InChIKey | UDMUWAGHYGOFSL-XPSQVAKYSA-N |
| XLogP | 7.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|