C18H19N3O4 — CID 54220192
(2S)-2-amino-3-[[3-(benzyldiazenyl)phenyl]methyl]butanedioic acid (PubChem CID 54220192) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2S)-2-amino-3-[[3-(benzyldiazenyl)phenyl]methyl]butanedioic acid.
| Compound Name | (2S)-2-amino-3-[[3-(benzyldiazenyl)phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 54220192 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-2-amino-3-[[3-(benzyldiazenyl)phenyl]methyl]butanedioic acid |
| SMILES | N[C@H](C(=O)O)C(Cc1cccc(/N=N/Cc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C18H19N3O4/c19-16(18(24)25)15(17(22)23)10-13-7-4-8-14(9-13)21-20-11-12-5-2-1-3-6-12/h1-9,15-16H,10-11,19H2,(H,22,23)(H,24,25)/b21-20+/t15?,16-/m0/s1 |
| InChIKey | QCAPQEIHTNYWTG-OUOQFUIYSA-N |
| XLogP | 2.63 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|