C20H22ClN3O4 — CID 90108288
(2S)-2-amino-3-phenylpropanoic acid;1,3-bis(isocyanatomethyl)benzene;chloromethane (PubChem CID 90108288) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;1,3-bis(isocyanatomethyl)benzene;chloromethane.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;1,3-bis(isocyanatomethyl)benzene;chloromethane |
|---|---|
| PubChem CID | 90108288 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;1,3-bis(isocyanatomethyl)benzene;chloromethane |
| SMILES | CCl.N[C@@H](Cc1ccccc1)C(=O)O.O=C=NCc1cccc(CN=C=O)c1 |
| InChI | InChI=1S/C10H8N2O2.C9H11NO2.CH3Cl/c13-7-11-5-9-2-1-3-10(4-9)6-12-8-14;10-8(9(11)12)6-7-4-2-1-3-5-7;1-2/h1-4H,5-6H2;1-5,8H,6,10H2,(H,11,12);1H3/t;8-;/m.0./s1 |
| InChIKey | WTORFRSUIQYVIP-JGUUTJLBSA-N |
| XLogP | 2.85 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|