C31H30O4 — CID 21221283
2-[3-(4-trityloxybutyl)phenoxy]acetic acid (PubChem CID 21221283) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[3-(4-trityloxybutyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(4-trityloxybutyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 21221283 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[3-(4-trityloxybutyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CCCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H30O4/c32-30(33)24-34-29-21-12-14-25(23-29)13-10-11-22-35-31(26-15-4-1-5-16-26,27-17-6-2-7-18-27)28-19-8-3-9-20-28/h1-9,12,14-21,23H,10-11,13,22,24H2,(H,32,33) |
| InChIKey | ATXCBBNBLVPPMN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|