C26H38N2O5 — CID 67075669
tert-butyl 3-amino-4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-2-oxobutanoate (PubChem CID 67075669) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-2-oxobutanoate.
| Compound Name | tert-butyl 3-amino-4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-2-oxobutanoate |
|---|---|
| PubChem CID | 67075669 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | tert-butyl 3-amino-4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-2-oxobutanoate |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2ccccc12)CC(N)C(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O5/c1-7-31-25(32-8-2)18(3)28(17-22(27)23(29)24(30)33-26(4,5)6)16-20-14-11-13-19-12-9-10-15-21(19)20/h9-15,18,22,25H,7-8,16-17,27H2,1-6H3/t18-,22?/m0/s1 |
| InChIKey | ZCFYIMXCNCZNIH-HXBUSHRASA-N |
| XLogP | 3.67 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|