C20H29ClN2O2 — CID 67571737
methyl 2-[(2-amino-3-methylpentyl)-(naphthalen-1-ylmethyl)amino]acetate;hydrochloride (PubChem CID 67571737) has the molecular formula C20H29ClN2O2 and a molecular weight of 364.92 g/mol. Its IUPAC name is methyl 2-[(2-amino-3-methylpentyl)-(naphthalen-1-ylmethyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-[(2-amino-3-methylpentyl)-(naphthalen-1-ylmethyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 67571737 |
| Molecular Formula | C20H29ClN2O2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | methyl 2-[(2-amino-3-methylpentyl)-(naphthalen-1-ylmethyl)amino]acetate;hydrochloride |
| SMILES | CCC(C)C(N)CN(CC(=O)OC)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C20H28N2O2.ClH/c1-4-15(2)19(21)13-22(14-20(23)24-3)12-17-10-7-9-16-8-5-6-11-18(16)17;/h5-11,15,19H,4,12-14,21H2,1-3H3;1H |
| InChIKey | UCRQAXWNKOFHLZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |