C36H50N6O7 — CID 67088309
tert-butyl (3S)-3-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]-4-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-4-oxobutanoate (PubChem CID 67088309) has the molecular formula C36H50N6O7 and a molecular weight of 678.83 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]-4-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]-4-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 67088309 |
| Molecular Formula | C36H50N6O7 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | tert-butyl (3S)-3-[[2-[(benzylcarbamoylamino)-methylamino]acetyl]amino]-4-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-4-oxobutanoate |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2cccnc12)C(=O)[C@H](CC(=O)OC(C)(C)C)NC(=O)CN(C)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C36H50N6O7/c1-8-47-34(48-9-2)25(3)42(23-28-18-13-17-27-19-14-20-37-32(27)28)33(45)29(21-31(44)49-36(4,5)6)39-30(43)24-41(7)40-35(46)38-22-26-15-11-10-12-16-26/h10-20,25,29,34H,8-9,21-24H2,1-7H3,(H,39,43)(H2,38,40,46)/t25-,29-/m0/s1 |
| InChIKey | KYKRDXRHCYLRAX-SVEHJYQDSA-N |
| XLogP | 3.91 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|