C18H24N2O4S3 — CID 70942706
tert-butyl N-[(5-amino-4-benzylsulfanylthiophen-3-yl)methyl]-N-methylsulfonylcarbamate (PubChem CID 70942706) has the molecular formula C18H24N2O4S3 and a molecular weight of 428.60 g/mol. Its IUPAC name is tert-butyl N-[(5-amino-4-benzylsulfanylthiophen-3-yl)methyl]-N-methylsulfonylcarbamate.
| Compound Name | tert-butyl N-[(5-amino-4-benzylsulfanylthiophen-3-yl)methyl]-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 70942706 |
| Molecular Formula | C18H24N2O4S3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | tert-butyl N-[(5-amino-4-benzylsulfanylthiophen-3-yl)methyl]-N-methylsulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1csc(N)c1SCc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H24N2O4S3/c1-18(2,3)24-17(21)20(27(4,22)23)10-14-12-26-16(19)15(14)25-11-13-8-6-5-7-9-13/h5-9,12H,10-11,19H2,1-4H3 |
| InChIKey | JSOCKXUEEAGIKW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |