C19H23NO4S — CID 124566602
tert-butyl (3S)-3-hydroxy-3-[2-(2-hydroxyphenyl)thiophen-3-yl]pyrrolidine-1-carboxylate (PubChem CID 124566602) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-3-[2-(2-hydroxyphenyl)thiophen-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-hydroxy-3-[2-(2-hydroxyphenyl)thiophen-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124566602 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-3-[2-(2-hydroxyphenyl)thiophen-3-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](O)(c2ccsc2-c2ccccc2O)C1 |
| InChI | InChI=1S/C19H23NO4S/c1-18(2,3)24-17(22)20-10-9-19(23,12-20)14-8-11-25-16(14)13-6-4-5-7-15(13)21/h4-8,11,21,23H,9-10,12H2,1-3H3/t19-/m1/s1 |
| InChIKey | GKYVFBVUIZKTPT-LJQANCHMSA-N |
| XLogP | 3.95 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |