C21H33NO3S — CID 10474870
tert-butyl 4-[2-(tert-butylsulfanylmethyl)phenyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 10474870) has the molecular formula C21H33NO3S and a molecular weight of 379.57 g/mol. Its IUPAC name is tert-butyl 4-[2-(tert-butylsulfanylmethyl)phenyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(tert-butylsulfanylmethyl)phenyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10474870 |
| Molecular Formula | C21H33NO3S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl 4-[2-(tert-butylsulfanylmethyl)phenyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccccc2CSC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H33NO3S/c1-19(2,3)25-18(23)22-13-11-21(24,12-14-22)17-10-8-7-9-16(17)15-26-20(4,5)6/h7-10,24H,11-15H2,1-6H3 |
| InChIKey | RFGNPOXOQFVBFN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |