C21H23Cl3N2O2 — CID 167445258
N'-[2-chloro-4-[3-[(2,5-dichlorophenyl)methoxy]oxetan-3-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 167445258) has the molecular formula C21H23Cl3N2O2 and a molecular weight of 441.79 g/mol. Its IUPAC name is N'-[2-chloro-4-[3-[(2,5-dichlorophenyl)methoxy]oxetan-3-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[3-[(2,5-dichlorophenyl)methoxy]oxetan-3-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 167445258 |
| Molecular Formula | C21H23Cl3N2O2 |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N'-[2-chloro-4-[3-[(2,5-dichlorophenyl)methoxy]oxetan-3-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C2(OCc3cc(Cl)ccc3Cl)COC2)cc1Cl |
| InChI | InChI=1S/C21H23Cl3N2O2/c1-4-26(3)13-25-20-7-14(2)17(9-19(20)24)21(11-27-12-21)28-10-15-8-16(22)5-6-18(15)23/h5-9,13H,4,10-12H2,1-3H3/b25-13+ |
| InChIKey | WFALXGURAZFMHO-DHRITJCHSA-N |
| XLogP | 6.01 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|