C20H23ClN2O2 — CID 155325361
2-phenylethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate (PubChem CID 155325361) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-phenylethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate.
| Compound Name | 2-phenylethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
|---|---|
| PubChem CID | 155325361 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-phenylethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(C(=O)OCCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H23ClN2O2/c1-4-23(3)14-22-19-13-18(21)17(12-15(19)2)20(24)25-11-10-16-8-6-5-7-9-16/h5-9,12-14H,4,10-11H2,1-3H3/b22-14+ |
| InChIKey | HTHOQBIEEWUUCM-HYARGMPZSA-N |
| XLogP | 4.66 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|