C18H21ClFN3O2S — CID 146197895
N'-[2-chloro-4-[(2-fluorophenyl)methylsulfonylamino]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197895) has the molecular formula C18H21ClFN3O2S and a molecular weight of 397.90 g/mol. Its IUPAC name is N'-[2-chloro-4-[(2-fluorophenyl)methylsulfonylamino]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[(2-fluorophenyl)methylsulfonylamino]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197895 |
| Molecular Formula | C18H21ClFN3O2S |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N'-[2-chloro-4-[(2-fluorophenyl)methylsulfonylamino]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(NS(=O)(=O)Cc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C18H21ClFN3O2S/c1-4-23(3)12-21-18-9-13(2)17(10-15(18)19)22-26(24,25)11-14-7-5-6-8-16(14)20/h5-10,12,22H,4,11H2,1-3H3/b21-12+ |
| InChIKey | AWKUORPDEUAZIN-CIAFOILYSA-N |
| XLogP | 4.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|