C19H20ClFN2O2 — CID 155325442
(2-fluorophenyl)methyl 3-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate (PubChem CID 155325442) has the molecular formula C19H20ClFN2O2 and a molecular weight of 362.83 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 3-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate.
| Compound Name | (2-fluorophenyl)methyl 3-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 155325442 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (2-fluorophenyl)methyl 3-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
| SMILES | CCN(C)/C=N/c1ccc(C(=O)OCc2ccccc2F)c(C)c1Cl |
| InChI | InChI=1S/C19H20ClFN2O2/c1-4-23(3)12-22-17-10-9-15(13(2)18(17)20)19(24)25-11-14-7-5-6-8-16(14)21/h5-10,12H,4,11H2,1-3H3/b22-12+ |
| InChIKey | LVRRZKASZBLESI-WSDLNYQXSA-N |
| XLogP | 4.76 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|