C21H22F4N2O2 — CID 155324837
[2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate (PubChem CID 155324837) has the molecular formula C21H22F4N2O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate.
| Compound Name | [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 155324837 |
| Molecular Formula | C21H22F4N2O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-fluoro-6-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C21H22F4N2O2/c1-5-27(4)12-26-19-10-9-15(13(2)14(19)3)20(28)29-11-16-17(21(23,24)25)7-6-8-18(16)22/h6-10,12H,5,11H2,1-4H3/b26-12+ |
| InChIKey | NPEXBXNENISYIP-RPPGKUMJSA-N |
| XLogP | 5.43 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|