C18H24F2N2O2 — CID 155325229
(3,3-difluorocyclobutyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate (PubChem CID 155325229) has the molecular formula C18H24F2N2O2 and a molecular weight of 338.40 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate.
| Compound Name | (3,3-difluorocyclobutyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 155325229 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3,3-difluorocyclobutyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1ccc(C(=O)OCC2CC(F)(F)C2)c(C)c1C |
| InChI | InChI=1S/C18H24F2N2O2/c1-5-22(4)11-21-16-7-6-15(12(2)13(16)3)17(23)24-10-14-8-18(19,20)9-14/h6-7,11,14H,5,8-10H2,1-4H3/b21-11+ |
| InChIKey | KNZWKZNMFLXQIT-SRZZPIQSSA-N |
| XLogP | 4.12 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|