C27H30N2O2 — CID 155324946
[(4-methylphenyl)-phenylmethyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate (PubChem CID 155324946) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is [(4-methylphenyl)-phenylmethyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate.
| Compound Name | [(4-methylphenyl)-phenylmethyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 155324946 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [(4-methylphenyl)-phenylmethyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1ccc(C(=O)OC(c2ccccc2)c2ccc(C)cc2)c(C)c1C |
| InChI | InChI=1S/C27H30N2O2/c1-6-29(5)18-28-25-17-16-24(20(3)21(25)4)27(30)31-26(22-10-8-7-9-11-22)23-14-12-19(2)13-15-23/h7-18,26H,6H2,1-5H3/b28-18+ |
| InChIKey | KKQMQMPYKBFGNZ-MTDXEUNCSA-N |
| XLogP | 6.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|