C21H26N2O2 — CID 155324949
1-(4-methylphenyl)ethyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate (PubChem CID 155324949) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)ethyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate.
| Compound Name | 1-(4-methylphenyl)ethyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 155324949 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(4-methylphenyl)ethyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
| SMILES | CCN(C)/C=N/c1ccc(C(=O)OC(C)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-6-23(5)14-22-19-11-12-20(16(3)13-19)21(24)25-17(4)18-9-7-15(2)8-10-18/h7-14,17H,6H2,1-5H3/b22-14+ |
| InChIKey | OCAFMQOYRIMAKJ-HYARGMPZSA-N |
| XLogP | 4.83 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|