C24H29F3N2O2 — CID 155324948
[4,4,4-trifluoro-1-(4-methylphenyl)butyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate (PubChem CID 155324948) has the molecular formula C24H29F3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(4-methylphenyl)butyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate.
| Compound Name | [4,4,4-trifluoro-1-(4-methylphenyl)butyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 155324948 |
| Molecular Formula | C24H29F3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [4,4,4-trifluoro-1-(4-methylphenyl)butyl] 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OC(CCC(F)(F)F)c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C24H29F3N2O2/c1-6-29(5)15-28-21-14-17(3)20(13-18(21)4)23(30)31-22(11-12-24(25,26)27)19-9-7-16(2)8-10-19/h7-10,13-15,22H,6,11-12H2,1-5H3/b28-15+ |
| InChIKey | OMURFEIXOPZDPX-RWPZCVJISA-N |
| XLogP | 6.46 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|