C18H20F2N2 — CID 154647678
N-ethyl-N'-[5-fluoro-3-[(3-fluorophenyl)methyl]-2-methylphenyl]-N-methylmethanimidamide (PubChem CID 154647678) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-ethyl-N'-[5-fluoro-3-[(3-fluorophenyl)methyl]-2-methylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-fluoro-3-[(3-fluorophenyl)methyl]-2-methylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647678 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-ethyl-N'-[5-fluoro-3-[(3-fluorophenyl)methyl]-2-methylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)cc(Cc2cccc(F)c2)c1C |
| InChI | InChI=1S/C18H20F2N2/c1-4-22(3)12-21-18-11-17(20)10-15(13(18)2)8-14-6-5-7-16(19)9-14/h5-7,9-12H,4,8H2,1-3H3/b21-12+ |
| InChIKey | XPOCYQHILHTCOO-CIAFOILYSA-N |
| XLogP | 4.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|