C19H20ClF3N2 — CID 154647900
N'-[5-chloro-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154647900) has the molecular formula C19H20ClF3N2 and a molecular weight of 368.83 g/mol. Its IUPAC name is N'-[5-chloro-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-chloro-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647900 |
| Molecular Formula | C19H20ClF3N2 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N'-[5-chloro-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Cl)cc(Cc2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C19H20ClF3N2/c1-4-25(3)12-24-18-11-17(20)10-15(13(18)2)9-14-5-7-16(8-6-14)19(21,22)23/h5-8,10-12H,4,9H2,1-3H3/b24-12+ |
| InChIKey | GXNLGIKYKZMSOP-WYMPLXKRSA-N |
| XLogP | 5.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|