C20H20ClF6N3 — CID 142322821
N'-[2-chloro-5-methyl-4-[N-methyl-3,5-bis(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 142322821) has the molecular formula C20H20ClF6N3 and a molecular weight of 451.84 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-4-[N-methyl-3,5-bis(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-4-[N-methyl-3,5-bis(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 142322821 |
| Molecular Formula | C20H20ClF6N3 |
| Molecular Weight | 451.84 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N'-[2-chloro-5-methyl-4-[N-methyl-3,5-bis(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C20H20ClF6N3/c1-5-29(3)11-28-17-6-12(2)18(10-16(17)21)30(4)15-8-13(19(22,23)24)7-14(9-15)20(25,26)27/h6-11H,5H2,1-4H3/b28-11+ |
| InChIKey | PULLGMIRXWHOFK-IPBVOBEMSA-N |
| XLogP | 7.07 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.84 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|