C19H21ClF3N3 — CID 142322898
N'-[2-chloro-5-methyl-4-[N-methyl-3-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 142322898) has the molecular formula C19H21ClF3N3 and a molecular weight of 383.85 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-4-[N-methyl-3-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-4-[N-methyl-3-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 142322898 |
| Molecular Formula | C19H21ClF3N3 |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N'-[2-chloro-5-methyl-4-[N-methyl-3-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)c2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C19H21ClF3N3/c1-5-25(3)12-24-17-9-13(2)18(11-16(17)20)26(4)15-8-6-7-14(10-15)19(21,22)23/h6-12H,5H2,1-4H3/b24-12+ |
| InChIKey | HBPWEZFPXCJTQK-WYMPLXKRSA-N |
| XLogP | 6.05 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|