C20H23ClF3N3O2S — CID 146381089
N'-[2-chloro-5-methyl-4-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146381089) has the molecular formula C20H23ClF3N3O2S and a molecular weight of 461.94 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-4-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-4-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146381089 |
| Molecular Formula | C20H23ClF3N3O2S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N'-[2-chloro-5-methyl-4-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(Cc2ccc(C(F)(F)F)cc2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C20H23ClF3N3O2S/c1-5-26(3)13-25-18-10-14(2)19(11-17(18)21)27(30(4,28)29)12-15-6-8-16(9-7-15)20(22,23)24/h6-11,13H,5,12H2,1-4H3/b25-13+ |
| InChIKey | ZFFMQLIJGAYEQE-DHRITJCHSA-N |
| XLogP | 5.24 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|