C21H24ClF3N2O2 — CID 162371239
4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethyl-5-[[3-(trifluoromethyl)phenyl]methyl]benzoic acid;hydrochloride (PubChem CID 162371239) has the molecular formula C21H24ClF3N2O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethyl-5-[[3-(trifluoromethyl)phenyl]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethyl-5-[[3-(trifluoromethyl)phenyl]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 162371239 |
| Molecular Formula | C21H24ClF3N2O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[[ethyl(methyl)amino]methylideneamino]-2,3-dimethyl-5-[[3-(trifluoromethyl)phenyl]methyl]benzoic acid;hydrochloride |
| SMILES | CCN(C)/C=N/c1c(Cc2cccc(C(F)(F)F)c2)cc(C(=O)O)c(C)c1C.Cl |
| InChI | InChI=1S/C21H23F3N2O2.ClH/c1-5-26(4)12-25-19-14(3)13(2)18(20(27)28)11-16(19)9-15-7-6-8-17(10-15)21(22,23)24;/h6-8,10-12H,5,9H2,1-4H3,(H,27,28);1H/b25-12+; |
| InChIKey | DBBYCIPQGNVFDT-CYUVEUGNSA-N |
| XLogP | 5.64 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|