C17H15F4NO — CID 175178417
N-[5-fluoro-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-N-methylformamide (PubChem CID 175178417) has the molecular formula C17H15F4NO and a molecular weight of 325.31 g/mol. Its IUPAC name is N-[5-fluoro-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-N-methylformamide.
| Compound Name | N-[5-fluoro-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-N-methylformamide |
|---|---|
| PubChem CID | 175178417 |
| Molecular Formula | C17H15F4NO |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[5-fluoro-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-N-methylformamide |
| SMILES | Cc1c(Cc2cccc(C(F)(F)F)c2)cc(F)cc1N(C)C=O |
| InChI | InChI=1S/C17H15F4NO/c1-11-13(8-15(18)9-16(11)22(2)10-23)6-12-4-3-5-14(7-12)17(19,20)21/h3-5,7-10H,6H2,1-2H3 |
| InChIKey | LEEROBGNDCWQEO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|