C17H18ClF2N3 — CID 154647865
N'-[3-(3-chloro-5-fluoroanilino)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154647865) has the molecular formula C17H18ClF2N3 and a molecular weight of 337.80 g/mol. Its IUPAC name is N'-[3-(3-chloro-5-fluoroanilino)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[3-(3-chloro-5-fluoroanilino)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647865 |
| Molecular Formula | C17H18ClF2N3 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N'-[3-(3-chloro-5-fluoroanilino)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)cc(Nc2cc(F)cc(Cl)c2)c1C |
| InChI | InChI=1S/C17H18ClF2N3/c1-4-23(3)10-21-16-8-14(20)9-17(11(16)2)22-15-6-12(18)5-13(19)7-15/h5-10,22H,4H2,1-3H3/b21-10+ |
| InChIKey | AFVOBUJSBQADCI-UFFVCSGVSA-N |
| XLogP | 5.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|