C25H28N2OS — CID 68598189
N'-[2,5-dimethyl-4-[4-(4-methylsulfanylphenyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 68598189) has the molecular formula C25H28N2OS and a molecular weight of 404.58 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[4-(4-methylsulfanylphenyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[4-(4-methylsulfanylphenyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 68598189 |
| Molecular Formula | C25H28N2OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N'-[2,5-dimethyl-4-[4-(4-methylsulfanylphenyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2ccc(-c3ccc(SC)cc3)cc2)cc1C |
| InChI | InChI=1S/C25H28N2OS/c1-6-27(4)17-26-24-15-19(3)25(16-18(24)2)28-22-11-7-20(8-12-22)21-9-13-23(29-5)14-10-21/h7-17H,6H2,1-5H3/b26-17+ |
| InChIKey | NUNNNFQRJONBMW-YZSQISJMSA-N |
| XLogP | 7.10 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|