C16H22F3N3O — CID 87491877
N'-[2,5-dimethyl-4-[(E)-C-methyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 87491877) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[(E)-C-methyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[(E)-C-methyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 87491877 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N'-[2,5-dimethyl-4-[(E)-C-methyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(/C(C)=N/OCC(F)(F)F)cc1C |
| InChI | InChI=1S/C16H22F3N3O/c1-6-22(5)10-20-15-8-11(2)14(7-12(15)3)13(4)21-23-9-16(17,18)19/h7-8,10H,6,9H2,1-5H3/b20-10+,21-13+ |
| InChIKey | IWFNOGYAYLQJCR-OYNCKMKSSA-N |
| XLogP | 4.22 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|