C22H23F3N2O2 — CID 155325113
[3-(trifluoromethyl)phenyl]methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate (PubChem CID 155325113) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate |
|---|---|
| PubChem CID | 155325113 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate |
| SMILES | Cc1c(/N=C/N2CCCC2)ccc(C(=O)OCc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C22H23F3N2O2/c1-15-16(2)20(26-14-27-10-3-4-11-27)9-8-19(15)21(28)29-13-17-6-5-7-18(12-17)22(23,24)25/h5-9,12,14H,3-4,10-11,13H2,1-2H3/b26-14+ |
| InChIKey | NEIKDWWPRGSDNT-VULFUBBASA-N |
| XLogP | 5.43 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|