C22H26N2O2 — CID 155324767
(4-methylphenyl)methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate (PubChem CID 155324767) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate.
| Compound Name | (4-methylphenyl)methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate |
|---|---|
| PubChem CID | 155324767 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (4-methylphenyl)methyl 2,3-dimethyl-4-(pyrrolidin-1-ylmethylideneamino)benzoate |
| SMILES | Cc1ccc(COC(=O)c2ccc(/N=C/N3CCCC3)c(C)c2C)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-16-6-8-19(9-7-16)14-26-22(25)20-10-11-21(18(3)17(20)2)23-15-24-12-4-5-13-24/h6-11,15H,4-5,12-14H2,1-3H3/b23-15+ |
| InChIKey | HQOSZWOVHQPUHO-HZHRSRAPSA-N |
| XLogP | 4.72 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|