C21H23NO3S — CID 55306418
(4-methylphenyl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 55306418) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | (4-methylphenyl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 55306418 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (4-methylphenyl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | Cc1ccc(COC(=O)c2ccccc2SCC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-16-8-10-17(11-9-16)14-25-21(24)18-6-2-3-7-19(18)26-15-20(23)22-12-4-5-13-22/h2-3,6-11H,4-5,12-15H2,1H3 |
| InChIKey | QGFSAXFYRPBXJO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |